C20H17Cl2N3O — CID 4565061
2-cyano-N-(2,4-dichlorophenyl)-3-(4-pyrrolidin-1-ylphenyl)prop-2-enamide (PubChem CID 4565061) has the molecular formula C20H17Cl2N3O and a molecular weight of 386.28 g/mol. Its IUPAC name is 2-cyano-N-(2,4-dichlorophenyl)-3-(4-pyrrolidin-1-ylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-N-(2,4-dichlorophenyl)-3-(4-pyrrolidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4565061 |
| Molecular Formula | C20H17Cl2N3O |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-cyano-N-(2,4-dichlorophenyl)-3-(4-pyrrolidin-1-ylphenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(N2CCCC2)cc1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl2N3O/c21-16-5-8-19(18(22)12-16)24-20(26)15(13-23)11-14-3-6-17(7-4-14)25-9-1-2-10-25/h3-8,11-12H,1-2,9-10H2,(H,24,26) |
| InChIKey | KHBXMMBVKGWBQV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|