C14H10Cl2N2O3 — CID 61092953
3-amino-N-(1,3-benzodioxol-5-yl)-4,5-dichlorobenzamide (PubChem CID 61092953) has the molecular formula C14H10Cl2N2O3 and a molecular weight of 325.15 g/mol. Its IUPAC name is 3-amino-N-(1,3-benzodioxol-5-yl)-4,5-dichlorobenzamide.
| Compound Name | 3-amino-N-(1,3-benzodioxol-5-yl)-4,5-dichlorobenzamide |
|---|---|
| PubChem CID | 61092953 |
| Molecular Formula | C14H10Cl2N2O3 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 3-amino-N-(1,3-benzodioxol-5-yl)-4,5-dichlorobenzamide |
| SMILES | Nc1cc(C(=O)Nc2ccc3c(c2)OCO3)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl2N2O3/c15-9-3-7(4-10(17)13(9)16)14(19)18-8-1-2-11-12(5-8)21-6-20-11/h1-5H,6,17H2,(H,18,19) |
| InChIKey | GYWFZHQQKVCEHD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|