C23H26N4O5S — CID 57340474
3-[4-[2-[[3-[(2-methyl-1,3-benzothiazol-6-yl)amino]-3-oxopropyl]carbamoylamino]ethoxy]phenyl]propanoic acid (PubChem CID 57340474) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is 3-[4-[2-[[3-[(2-methyl-1,3-benzothiazol-6-yl)amino]-3-oxopropyl]carbamoylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-[[3-[(2-methyl-1,3-benzothiazol-6-yl)amino]-3-oxopropyl]carbamoylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 57340474 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 3-[4-[2-[[3-[(2-methyl-1,3-benzothiazol-6-yl)amino]-3-oxopropyl]carbamoylamino]ethoxy]phenyl]propanoic acid |
| SMILES | Cc1nc2ccc(NC(=O)CCNC(=O)NCCOc3ccc(CCC(=O)O)cc3)cc2s1 |
| InChI | InChI=1S/C23H26N4O5S/c1-15-26-19-8-5-17(14-20(19)33-15)27-21(28)10-11-24-23(31)25-12-13-32-18-6-2-16(3-7-18)4-9-22(29)30/h2-3,5-8,14H,4,9-13H2,1H3,(H,27,28)(H,29,30)(H2,24,25,31) |
| InChIKey | FVQKLUULQXPDHM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|