C16H23N3O2S — CID 86856044
1-(2-methyl-1,3-benzothiazol-6-yl)-3-[2-(3-methylbutoxy)ethyl]urea (PubChem CID 86856044) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-(2-methyl-1,3-benzothiazol-6-yl)-3-[2-(3-methylbutoxy)ethyl]urea.
| Compound Name | 1-(2-methyl-1,3-benzothiazol-6-yl)-3-[2-(3-methylbutoxy)ethyl]urea |
|---|---|
| PubChem CID | 86856044 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-(2-methyl-1,3-benzothiazol-6-yl)-3-[2-(3-methylbutoxy)ethyl]urea |
| SMILES | Cc1nc2ccc(NC(=O)NCCOCCC(C)C)cc2s1 |
| InChI | InChI=1S/C16H23N3O2S/c1-11(2)6-8-21-9-7-17-16(20)19-13-4-5-14-15(10-13)22-12(3)18-14/h4-5,10-11H,6-9H2,1-3H3,(H2,17,19,20) |
| InChIKey | QGAPLGGZAKQWRZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|