C19H21N3O3S2 — CID 26116899
3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)propanamide (PubChem CID 26116899) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)propanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)propanamide |
|---|---|
| PubChem CID | 26116899 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)propanamide |
| SMILES | CSc1nc2ccc(NC(=O)CCN3C(=O)[C@H]4CCCC[C@H]4C3=O)cc2s1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-26-19-21-14-7-6-11(10-15(14)27-19)20-16(23)8-9-22-17(24)12-4-2-3-5-13(12)18(22)25/h6-7,10,12-13H,2-5,8-9H2,1H3,(H,20,23)/t12-,13+ |
| InChIKey | AYSDAFPZINESIJ-BETUJISGSA-N |
| XLogP | 3.52 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|