C18H18FN3O3S — CID 2694590
3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)propanamide (PubChem CID 2694590) has the molecular formula C18H18FN3O3S and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 2694590 |
| Molecular Formula | C18H18FN3O3S |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C18H18FN3O3S/c19-10-5-6-13-14(9-10)26-18(20-13)21-15(23)7-8-22-16(24)11-3-1-2-4-12(11)17(22)25/h5-6,9,11-12H,1-4,7-8H2,(H,20,21,23)/t11-,12-/m1/s1 |
| InChIKey | KJEJIJLKUPAYCK-VXGBXAGGSA-N |
| XLogP | 2.94 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|