C20H22N4O2S2 — CID 2466165
N'-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoyl]-3-(dimethylamino)benzohydrazide (PubChem CID 2466165) has the molecular formula C20H22N4O2S2 and a molecular weight of 414.56 g/mol. Its IUPAC name is N'-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoyl]-3-(dimethylamino)benzohydrazide.
| Compound Name | N'-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoyl]-3-(dimethylamino)benzohydrazide |
|---|---|
| PubChem CID | 2466165 |
| Molecular Formula | C20H22N4O2S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N'-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoyl]-3-(dimethylamino)benzohydrazide |
| SMILES | CN(C)c1cccc(C(=O)NNC(=O)CCCSc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H22N4O2S2/c1-24(2)15-8-5-7-14(13-15)19(26)23-22-18(25)11-6-12-27-20-21-16-9-3-4-10-17(16)28-20/h3-5,7-10,13H,6,11-12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | TUOCDLSOWGATLL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|