C17H14F3N3O2S — CID 134100741
1-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 134100741) has the molecular formula C17H14F3N3O2S and a molecular weight of 381.38 g/mol. Its IUPAC name is 1-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 134100741 |
| Molecular Formula | C17H14F3N3O2S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCSc1nc2ccccc2o1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3N3O2S/c18-17(19,20)11-5-7-12(8-6-11)22-15(24)21-9-10-26-16-23-13-3-1-2-4-14(13)25-16/h1-8H,9-10H2,(H2,21,22,24) |
| InChIKey | NLGYRPQDNBQBSY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|