C19H14F3NO3S — CID 77461110
methyl (Z)-2-(1,3-benzoxazol-2-ylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 77461110) has the molecular formula C19H14F3NO3S and a molecular weight of 393.39 g/mol. Its IUPAC name is methyl (Z)-2-(1,3-benzoxazol-2-ylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | methyl (Z)-2-(1,3-benzoxazol-2-ylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 77461110 |
| Molecular Formula | C19H14F3NO3S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | methyl (Z)-2-(1,3-benzoxazol-2-ylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc(C(F)(F)F)cc1)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C19H14F3NO3S/c1-25-17(24)13(10-12-6-8-14(9-7-12)19(20,21)22)11-27-18-23-15-4-2-3-5-16(15)26-18/h2-10H,11H2,1H3/b13-10+ |
| InChIKey | NZKVMPSIOMCNTA-JLHYYAGUSA-N |
| XLogP | 5.20 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|