C13H13NO3S — CID 77074451
methyl 4-(1,3-benzoxazol-2-ylsulfanyl)-2-methylbut-2-enoate (PubChem CID 77074451) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is methyl 4-(1,3-benzoxazol-2-ylsulfanyl)-2-methylbut-2-enoate.
| Compound Name | methyl 4-(1,3-benzoxazol-2-ylsulfanyl)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 77074451 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | methyl 4-(1,3-benzoxazol-2-ylsulfanyl)-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCSc1nc2ccccc2o1 |
| InChI | InChI=1S/C13H13NO3S/c1-9(12(15)16-2)7-8-18-13-14-10-5-3-4-6-11(10)17-13/h3-7H,8H2,1-2H3 |
| InChIKey | ZATJZCLYAUNVGV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|