C15H17N3O5S2 — CID 87673885
methyl 2-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-3-methyl-3-nitrososulfanylbutanoate (PubChem CID 87673885) has the molecular formula C15H17N3O5S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is methyl 2-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-3-methyl-3-nitrososulfanylbutanoate.
| Compound Name | methyl 2-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-3-methyl-3-nitrososulfanylbutanoate |
|---|---|
| PubChem CID | 87673885 |
| Molecular Formula | C15H17N3O5S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | methyl 2-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-3-methyl-3-nitrososulfanylbutanoate |
| SMILES | COC(=O)C(NC(=O)CSc1nc2ccccc2o1)C(C)(C)SN=O |
| InChI | InChI=1S/C15H17N3O5S2/c1-15(2,25-18-21)12(13(20)22-3)17-11(19)8-24-14-16-9-6-4-5-7-10(9)23-14/h4-7,12H,8H2,1-3H3,(H,17,19) |
| InChIKey | APHUQTSAROJIAH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|