C18H24N2OS — CID 4670655
1-(1-adamantyl)-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone (PubChem CID 4670655) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone.
| Compound Name | 1-(1-adamantyl)-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 4670655 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-(1-adamantyl)-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone |
| SMILES | Cc1cc(C)nc(SCC(=O)C23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C18H24N2OS/c1-11-3-12(2)20-17(19-11)22-10-16(21)18-7-13-4-14(8-18)6-15(5-13)9-18/h3,13-15H,4-10H2,1-2H3 |
| InChIKey | CGYBHVUSAVJKCP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |