C10H16N8O2S — CID 80928785
3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 80928785) has the molecular formula C10H16N8O2S and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 80928785 |
| Molecular Formula | C10H16N8O2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | CCOc1nc(NN)nc(Sc2n[nH]c(=O)n2C(C)C)n1 |
| InChI | InChI=1S/C10H16N8O2S/c1-4-20-7-12-6(15-11)13-8(14-7)21-10-17-16-9(19)18(10)5(2)3/h5H,4,11H2,1-3H3,(H,16,19)(H,12,13,14,15) |
| InChIKey | PWSOAQYJVJRQEO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|