C7H14N8O — CID 80932664
2-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]acetamide (PubChem CID 80932664) has the molecular formula C7H14N8O and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]acetamide.
| Compound Name | 2-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 80932664 |
| Molecular Formula | C7H14N8O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]acetamide |
| SMILES | CN(C)c1nc(NN)nc(NCC(N)=O)n1 |
| InChI | InChI=1S/C7H14N8O/c1-15(2)7-12-5(10-3-4(8)16)11-6(13-7)14-9/h3,9H2,1-2H3,(H2,8,16)(H2,10,11,12,13,14) |
| InChIKey | DXBGKDITKYGYDL-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|