C10H21N7O2S — CID 80929618
6-hydrazinyl-4-N,4-N-dimethyl-2-N-(2-methyl-2-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80929618) has the molecular formula C10H21N7O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(2-methyl-2-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(2-methyl-2-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80929618 |
| Molecular Formula | C10H21N7O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(2-methyl-2-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(NN)nc(NCC(C)(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H21N7O2S/c1-10(2,20(5,18)19)6-12-7-13-8(16-11)15-9(14-7)17(3)4/h6,11H2,1-5H3,(H2,12,13,14,15,16) |
| InChIKey | MONIAUBIZZBBCF-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|