About 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide
2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide (PubChem CID 114133403) has the molecular formula C10H18N6O2
and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide |
| PubChem CID | 114133403 |
| Molecular Formula | C10H18N6O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide |
| SMILES | CCOc1nc(N)nc(NCC(=O)N(C)CC)n1 |
| InChI | InChI=1S/C10H18N6O2/c1-4-16(3)7(17)6-12-9-13-8(11)14-10(15-9)18-5-2/h4-6H2,1-3H3,(H3,11,12,13,14,15) |
| InChIKey | NBZCIJDMYJMGJV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide?
The IUPAC name of 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide (CID 114133403) is 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide.
What is the SMILES notation for 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide?
The canonical SMILES for 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide is CCOc1nc(N)nc(NCC(=O)N(C)CC)n1.
What is the InChIKey of 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide?
The InChIKey is NBZCIJDMYJMGJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N6O2/c1-4-16(3)7(17)6-12-9-13-8(11)14-10(15-9)18-5-2/h4-6H2,1-3H3,(H3,11,12,13,14,15).
What are the key properties of 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide?
2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide has a molecular weight of 254.29 g/mol, XLogP of -0.26, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-ethyl-N-methylacetamide is sourced from PubChem (CID 114133403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).