C7H10ClN3OS — CID 62865803
2-chloro-4-methylsulfanyl-6-propoxy-1,3,5-triazine (PubChem CID 62865803) has the molecular formula C7H10ClN3OS and a molecular weight of 219.70 g/mol. Its IUPAC name is 2-chloro-4-methylsulfanyl-6-propoxy-1,3,5-triazine.
| Compound Name | 2-chloro-4-methylsulfanyl-6-propoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 62865803 |
| Molecular Formula | C7H10ClN3OS |
| Molecular Weight | 219.70 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 2-chloro-4-methylsulfanyl-6-propoxy-1,3,5-triazine |
| SMILES | CCCOc1nc(Cl)nc(SC)n1 |
| InChI | InChI=1S/C7H10ClN3OS/c1-3-4-12-6-9-5(8)10-7(11-6)13-2/h3-4H2,1-2H3 |
| InChIKey | SENPDMGFEMFBMU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.70 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |