C10H17N9 — CID 80854271
2-N,2-N-dimethyl-4-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 80854271) has the molecular formula C10H17N9 and a molecular weight of 263.31 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-dimethyl-4-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80854271 |
| Molecular Formula | C10H17N9 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-N,2-N-dimethyl-4-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N)nc(NCCc2ncn(C)n2)n1 |
| InChI | InChI=1S/C10H17N9/c1-18(2)10-15-8(11)14-9(16-10)12-5-4-7-13-6-19(3)17-7/h6H,4-5H2,1-3H3,(H3,11,12,14,15,16) |
| InChIKey | YQPCKFAIOIMXON-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |