C9H15N9 — CID 80926867
6-hydrazinyl-4-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]pyrimidine-2,4-diamine (PubChem CID 80926867) has the molecular formula C9H15N9 and a molecular weight of 249.28 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80926867 |
| Molecular Formula | C9H15N9 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 6-hydrazinyl-4-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]pyrimidine-2,4-diamine |
| SMILES | Cn1cnc(CCNc2cc(NN)nc(N)n2)n1 |
| InChI | InChI=1S/C9H15N9/c1-18-5-13-6(17-18)2-3-12-7-4-8(16-11)15-9(10)14-7/h4-5H,2-3,11H2,1H3,(H4,10,12,14,15,16) |
| InChIKey | JIIXQTRGZAEFGC-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|