C10H14N4 — CID 86697416
N-butylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 86697416) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is N-butylpyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-butylpyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 86697416 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N-butylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CCCCNc1ccn2nccc2n1 |
| InChI | InChI=1S/C10H14N4/c1-2-3-6-11-9-5-8-14-10(13-9)4-7-12-14/h4-5,7-8H,2-3,6H2,1H3,(H,11,13) |
| InChIKey | CTLHUJXIVFTLIJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|