C10H10F4N2S2 — CID 113254725
N-(1,4-dithian-2-ylmethyl)-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 113254725) has the molecular formula C10H10F4N2S2 and a molecular weight of 298.33 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 113254725 |
| Molecular Formula | C10H10F4N2S2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(NCC2CSCCS2)c1F |
| InChI | InChI=1S/C10H10F4N2S2/c11-6-8(7(12)10(14)16-9(6)13)15-3-5-4-17-1-2-18-5/h5H,1-4H2,(H,15,16) |
| InChIKey | WGTJDQDNWYZAQF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|