C13H18N2O2S2 — CID 113489440
2-(1,4-dithian-2-ylmethylamino)-6-ethylpyridine-4-carboxylic acid (PubChem CID 113489440) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-(1,4-dithian-2-ylmethylamino)-6-ethylpyridine-4-carboxylic acid.
| Compound Name | 2-(1,4-dithian-2-ylmethylamino)-6-ethylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 113489440 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-(1,4-dithian-2-ylmethylamino)-6-ethylpyridine-4-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)cc(NCC2CSCCS2)n1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-2-10-5-9(13(16)17)6-12(15-10)14-7-11-8-18-3-4-19-11/h5-6,11H,2-4,7-8H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | KNIIRHIQUBBVDX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |