C12H16N2O2S2 — CID 113489573
4-amino-3-(1,4-dithian-2-ylmethylamino)benzoic acid (PubChem CID 113489573) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-amino-3-(1,4-dithian-2-ylmethylamino)benzoic acid.
| Compound Name | 4-amino-3-(1,4-dithian-2-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 113489573 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-amino-3-(1,4-dithian-2-ylmethylamino)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)cc1NCC1CSCCS1 |
| InChI | InChI=1S/C12H16N2O2S2/c13-10-2-1-8(12(15)16)5-11(10)14-6-9-7-17-3-4-18-9/h1-2,5,9,14H,3-4,6-7,13H2,(H,15,16) |
| InChIKey | BFKBTVJLWKAAAV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|