C12H16N4O3S — CID 80586206
5-hydrazinyl-2-nitro-N-(thiolan-2-ylmethyl)benzamide (PubChem CID 80586206) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 5-hydrazinyl-2-nitro-N-(thiolan-2-ylmethyl)benzamide.
| Compound Name | 5-hydrazinyl-2-nitro-N-(thiolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 80586206 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-hydrazinyl-2-nitro-N-(thiolan-2-ylmethyl)benzamide |
| SMILES | NNc1ccc([N+](=O)[O-])c(C(=O)NCC2CCCS2)c1 |
| InChI | InChI=1S/C12H16N4O3S/c13-15-8-3-4-11(16(18)19)10(6-8)12(17)14-7-9-2-1-5-20-9/h3-4,6,9,15H,1-2,5,7,13H2,(H,14,17) |
| InChIKey | JJHXAAVSILNMGH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|