C14H11ClN4O2 — CID 106766043
1-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]isoquinoline-4-carboxamide (PubChem CID 106766043) has the molecular formula C14H11ClN4O2 and a molecular weight of 302.72 g/mol. Its IUPAC name is 1-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]isoquinoline-4-carboxamide.
| Compound Name | 1-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106766043 |
| Molecular Formula | C14H11ClN4O2 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]isoquinoline-4-carboxamide |
| SMILES | Cc1noc(CNC(=O)c2cnc(Cl)c3ccccc23)n1 |
| InChI | InChI=1S/C14H11ClN4O2/c1-8-18-12(21-19-8)7-17-14(20)11-6-16-13(15)10-5-3-2-4-9(10)11/h2-6H,7H2,1H3,(H,17,20) |
| InChIKey | LDMXIGJOVNRAPD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|