C9H6ClN5O4 — CID 114089801
2-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)-5-nitropyridine-4-carboxamide (PubChem CID 114089801) has the molecular formula C9H6ClN5O4 and a molecular weight of 283.63 g/mol. Its IUPAC name is 2-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)-5-nitropyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)-5-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 114089801 |
| Molecular Formula | C9H6ClN5O4 |
| Molecular Weight | 283.63 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 2-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)-5-nitropyridine-4-carboxamide |
| SMILES | Cc1nnc(NC(=O)c2cc(Cl)ncc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C9H6ClN5O4/c1-4-13-14-9(19-4)12-8(16)5-2-7(10)11-3-6(5)15(17)18/h2-3H,1H3,(H,12,14,16) |
| InChIKey | HYHBQRXRNMLTND-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.63 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|