C11H10BrF4NO — CID 106290959
4-(bromomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 106290959) has the molecular formula C11H10BrF4NO and a molecular weight of 328.10 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 4-(bromomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 106290959 |
| Molecular Formula | C11H10BrF4NO |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 4-(bromomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | O=C(NCC(F)(F)C(F)F)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C11H10BrF4NO/c12-5-7-1-3-8(4-2-7)9(18)17-6-11(15,16)10(13)14/h1-4,10H,5-6H2,(H,17,18) |
| InChIKey | FDZUVGIFBDMLNZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|