C11H11BrF3NO — CID 139330806
2-[4-(bromomethyl)phenyl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 139330806) has the molecular formula C11H11BrF3NO and a molecular weight of 310.11 g/mol. Its IUPAC name is 2-[4-(bromomethyl)phenyl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-(bromomethyl)phenyl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 139330806 |
| Molecular Formula | C11H11BrF3NO |
| Molecular Weight | 310.11 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 2-[4-(bromomethyl)phenyl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cc1ccc(CBr)cc1)NCC(F)(F)F |
| InChI | InChI=1S/C11H11BrF3NO/c12-6-9-3-1-8(2-4-9)5-10(17)16-7-11(13,14)15/h1-4H,5-7H2,(H,16,17) |
| InChIKey | AEKDBGYQEOCYSB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.11 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|