C13H13F3N2O4 — CID 120537771
2-[4-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]phenyl]acetic acid (PubChem CID 120537771) has the molecular formula C13H13F3N2O4 and a molecular weight of 318.25 g/mol. Its IUPAC name is 2-[4-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 120537771 |
| Molecular Formula | C13H13F3N2O4 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[4-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)CC(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F3N2O4/c14-13(15,16)7-17-10(19)6-11(20)18-9-3-1-8(2-4-9)5-12(21)22/h1-4H,5-7H2,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | SIDAQVBGNWMWTL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|