C12H13F4N3O — CID 106293073
N-(2,2,3,3-tetrafluoropropyl)-1,2,3,4-tetrahydroquinoxaline-6-carboxamide (PubChem CID 106293073) has the molecular formula C12H13F4N3O and a molecular weight of 291.25 g/mol. Its IUPAC name is N-(2,2,3,3-tetrafluoropropyl)-1,2,3,4-tetrahydroquinoxaline-6-carboxamide.
| Compound Name | N-(2,2,3,3-tetrafluoropropyl)-1,2,3,4-tetrahydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 106293073 |
| Molecular Formula | C12H13F4N3O |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-(2,2,3,3-tetrafluoropropyl)-1,2,3,4-tetrahydroquinoxaline-6-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)F)c1ccc2c(c1)NCCN2 |
| InChI | InChI=1S/C12H13F4N3O/c13-11(14)12(15,16)6-19-10(20)7-1-2-8-9(5-7)18-4-3-17-8/h1-2,5,11,17-18H,3-4,6H2,(H,19,20) |
| InChIKey | LUQASNMKQKIMIT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|