C12H16N4O3 — CID 104615254
2-(1,2,3,4-tetrahydroquinoxaline-6-carbonylamino)ethyl carbamate (PubChem CID 104615254) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydroquinoxaline-6-carbonylamino)ethyl carbamate.
| Compound Name | 2-(1,2,3,4-tetrahydroquinoxaline-6-carbonylamino)ethyl carbamate |
|---|---|
| PubChem CID | 104615254 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-(1,2,3,4-tetrahydroquinoxaline-6-carbonylamino)ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)c1ccc2c(c1)NCCN2 |
| InChI | InChI=1S/C12H16N4O3/c13-12(18)19-6-5-16-11(17)8-1-2-9-10(7-8)15-4-3-14-9/h1-2,7,14-15H,3-6H2,(H2,13,18)(H,16,17) |
| InChIKey | QFBSVDYPTRQVTC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|