About 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride
1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride (PubChem CID 175001526) has the molecular formula C21H24ClNO3
and a molecular weight of 373.88 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride |
| PubChem CID | 175001526 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride |
| SMILES | C=C(Cc1ccc(C(=O)c2ccccc2)cc1)C(=O)OC(C)N(C)C.Cl |
| InChI | InChI=1S/C21H23NO3.ClH/c1-15(21(24)25-16(2)22(3)4)14-17-10-12-19(13-11-17)20(23)18-8-6-5-7-9-18;/h5-13,16H,1,14H2,2-4H3;1H |
| InChIKey | QFOGRQSKAVKYCF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride?
The IUPAC name of 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride (CID 175001526) is 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride.
What is the SMILES notation for 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride?
The canonical SMILES for 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride is C=C(Cc1ccc(C(=O)c2ccccc2)cc1)C(=O)OC(C)N(C)C.Cl.
What is the InChIKey of 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride?
The InChIKey is QFOGRQSKAVKYCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO3.ClH/c1-15(21(24)25-16(2)22(3)4)14-17-10-12-19(13-11-17)20(23)18-8-6-5-7-9-18;/h5-13,16H,1,14H2,2-4H3;1H.
What are the key properties of 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride?
1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride has a molecular weight of 373.88 g/mol, XLogP of 3.89, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl 2-[(4-benzoylphenyl)methyl]prop-2-enoate;hydrochloride is sourced from PubChem (CID 175001526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).