C36H38FN7O2 — CID 164843020
2-[4-[[3-fluoro-4-[[4-[(4-hexylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl prop-2-enoate (PubChem CID 164843020) has the molecular formula C36H38FN7O2 and a molecular weight of 619.75 g/mol. Its IUPAC name is 2-[4-[[3-fluoro-4-[[4-[(4-hexylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl prop-2-enoate.
| Compound Name | 2-[4-[[3-fluoro-4-[[4-[(4-hexylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 164843020 |
| Molecular Formula | C36H38FN7O2 |
| Molecular Weight | 619.75 g/mol |
| Exact Mass | 619.31 |
| IUPAC Name | 2-[4-[[3-fluoro-4-[[4-[(4-hexylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(C)c1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4ccc(CCCCCC)cc4)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C36H38FN7O2/c1-4-6-7-8-9-27-10-12-28(13-11-27)38-39-29-14-16-30(17-15-29)41-43-35-23-20-32(26-34(35)37)42-40-31-18-21-33(22-19-31)44(3)24-25-46-36(45)5-2/h5,10-23,26H,2,4,6-9,24-25H2,1,3H3/b39-38+,42-40+,43-41+ |
| InChIKey | MUNILNQOPHHHPG-CSJPDCIZSA-N |
| XLogP | 11.36 |
| TPSA | 103.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.75 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|