C45H50FN5O7 — CID 167287618
4-(2-methylprop-2-enoyloxy)butyl 4-[[2-fluoro-4-[[4-[3-[4-(1-prop-2-enoyloxyhexan-3-yl)anilino]propyl]phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoate (PubChem CID 167287618) has the molecular formula C45H50FN5O7 and a molecular weight of 791.92 g/mol. Its IUPAC name is 4-(2-methylprop-2-enoyloxy)butyl 4-[[2-fluoro-4-[[4-[3-[4-(1-prop-2-enoyloxyhexan-3-yl)anilino]propyl]phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoate.
| Compound Name | 4-(2-methylprop-2-enoyloxy)butyl 4-[[2-fluoro-4-[[4-[3-[4-(1-prop-2-enoyloxyhexan-3-yl)anilino]propyl]phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 167287618 |
| Molecular Formula | C45H50FN5O7 |
| Molecular Weight | 791.92 g/mol |
| Exact Mass | 791.37 |
| IUPAC Name | 4-(2-methylprop-2-enoyloxy)butyl 4-[[2-fluoro-4-[[4-[3-[4-(1-prop-2-enoyloxyhexan-3-yl)anilino]propyl]phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoate |
| SMILES | C=CC(=O)OCCC(CCC)c1ccc(NCCCc2ccc(/N=N/c3ccc(/N=N/c4ccc(C(=O)OCCCCOC(=O)C(=C)C)c(O)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C45H50FN5O7/c1-5-10-33(24-28-56-43(53)6-2)34-14-18-35(19-15-34)47-25-9-11-32-12-16-36(17-13-32)48-49-37-21-23-41(40(46)29-37)51-50-38-20-22-39(42(52)30-38)45(55)58-27-8-7-26-57-44(54)31(3)4/h6,12-23,29-30,33,47,52H,2-3,5,7-11,24-28H2,1,4H3/b49-48+,51-50+ |
| InChIKey | MYQZFJWDICFKEP-NWGLVOSDSA-N |
| XLogP | 11.47 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.92 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|