C30H37FN4 — CID 164842926
4-[[2-fluoro-4-[(4-nonylphenyl)iminomethyl]phenyl]diazenyl]-N,N-dimethylaniline (PubChem CID 164842926) has the molecular formula C30H37FN4 and a molecular weight of 472.65 g/mol. Its IUPAC name is 4-[[2-fluoro-4-[(4-nonylphenyl)iminomethyl]phenyl]diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[[2-fluoro-4-[(4-nonylphenyl)iminomethyl]phenyl]diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 164842926 |
| Molecular Formula | C30H37FN4 |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 4-[[2-fluoro-4-[(4-nonylphenyl)iminomethyl]phenyl]diazenyl]-N,N-dimethylaniline |
| SMILES | CCCCCCCCCc1ccc(/N=C/c2ccc(/N=N/c3ccc(N(C)C)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C30H37FN4/c1-4-5-6-7-8-9-10-11-24-12-15-26(16-13-24)32-23-25-14-21-30(29(31)22-25)34-33-27-17-19-28(20-18-27)35(2)3/h12-23H,4-11H2,1-3H3/b32-23+,34-33+ |
| InChIKey | YZZYABJXHFARSE-SCUPENOCSA-N |
| XLogP | 9.35 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|