C22H26N2O4S2 — CID 57239842
2-[5-[(2R)-2-methylbutyl]sulfonyl-2-phenyldiazenylphenyl]sulfanylethyl prop-2-enoate (PubChem CID 57239842) has the molecular formula C22H26N2O4S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2-[5-[(2R)-2-methylbutyl]sulfonyl-2-phenyldiazenylphenyl]sulfanylethyl prop-2-enoate.
| Compound Name | 2-[5-[(2R)-2-methylbutyl]sulfonyl-2-phenyldiazenylphenyl]sulfanylethyl prop-2-enoate |
|---|---|
| PubChem CID | 57239842 |
| Molecular Formula | C22H26N2O4S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-[5-[(2R)-2-methylbutyl]sulfonyl-2-phenyldiazenylphenyl]sulfanylethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCSc1cc(S(=O)(=O)C[C@H](C)CC)ccc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C22H26N2O4S2/c1-4-17(3)16-30(26,27)19-11-12-20(24-23-18-9-7-6-8-10-18)21(15-19)29-14-13-28-22(25)5-2/h5-12,15,17H,2,4,13-14,16H2,1,3H3/b24-23+/t17-/m1/s1 |
| InChIKey | MGDLTVULDINDPA-GSWFEHRJSA-N |
| XLogP | 5.74 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|