C25H27N3O4 — CID 143490823
2-[N-methyl-4-[[3-(methylcarbamoyl)-4-oxonaphthalen-1-ylidene]amino]anilino]ethyl 2-methylpropanoate (PubChem CID 143490823) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[N-methyl-4-[[3-(methylcarbamoyl)-4-oxonaphthalen-1-ylidene]amino]anilino]ethyl 2-methylpropanoate.
| Compound Name | 2-[N-methyl-4-[[3-(methylcarbamoyl)-4-oxonaphthalen-1-ylidene]amino]anilino]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 143490823 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-[N-methyl-4-[[3-(methylcarbamoyl)-4-oxonaphthalen-1-ylidene]amino]anilino]ethyl 2-methylpropanoate |
| SMILES | CNC(=O)C1=C/C(=N\c2ccc(N(C)CCOC(=O)C(C)C)cc2)c2ccccc2C1=O |
| InChI | InChI=1S/C25H27N3O4/c1-16(2)25(31)32-14-13-28(4)18-11-9-17(10-12-18)27-22-15-21(24(30)26-3)23(29)20-8-6-5-7-19(20)22/h5-12,15-16H,13-14H2,1-4H3,(H,26,30)/b27-22+ |
| InChIKey | IDLJCHPWNNFYAD-HPNDGRJYSA-N |
| XLogP | 3.31 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|