C13H17N3O2 — CID 163479998
3-[4-(ethenyldiazenyl)-N-ethylanilino]propanoic acid (PubChem CID 163479998) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-[4-(ethenyldiazenyl)-N-ethylanilino]propanoic acid.
| Compound Name | 3-[4-(ethenyldiazenyl)-N-ethylanilino]propanoic acid |
|---|---|
| PubChem CID | 163479998 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3-[4-(ethenyldiazenyl)-N-ethylanilino]propanoic acid |
| SMILES | C=C/N=N/c1ccc(N(CC)CCC(=O)O)cc1 |
| InChI | InChI=1S/C13H17N3O2/c1-3-14-15-11-5-7-12(8-6-11)16(4-2)10-9-13(17)18/h3,5-8H,1,4,9-10H2,2H3,(H,17,18)/b15-14+ |
| InChIKey | CDSQGFCHVUATBE-CCEZHUSRSA-N |
| XLogP | 3.21 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|