C20H22F3N3O2 — CID 20823466
2-[N-ethyl-4-[[4-methyl-3-(trifluoromethyl)phenyl]diazenyl]anilino]ethyl acetate (PubChem CID 20823466) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 2-[N-ethyl-4-[[4-methyl-3-(trifluoromethyl)phenyl]diazenyl]anilino]ethyl acetate.
| Compound Name | 2-[N-ethyl-4-[[4-methyl-3-(trifluoromethyl)phenyl]diazenyl]anilino]ethyl acetate |
|---|---|
| PubChem CID | 20823466 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[N-ethyl-4-[[4-methyl-3-(trifluoromethyl)phenyl]diazenyl]anilino]ethyl acetate |
| SMILES | CCN(CCOC(C)=O)c1ccc(/N=N/c2ccc(C)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H22F3N3O2/c1-4-26(11-12-28-15(3)27)18-9-7-16(8-10-18)24-25-17-6-5-14(2)19(13-17)20(21,22)23/h5-10,13H,4,11-12H2,1-3H3/b25-24+ |
| InChIKey | YFBGGWAAQGTPIW-OCOZRVBESA-N |
| XLogP | 5.82 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|