C18H17BrCl2FN3O4S — CID 18793667
2-[4-[(2-bromo-3,6-dichloro-4-fluorosulfonylphenyl)diazenyl]-N-ethylanilino]ethyl acetate (PubChem CID 18793667) has the molecular formula C18H17BrCl2FN3O4S and a molecular weight of 541.23 g/mol. Its IUPAC name is 2-[4-[(2-bromo-3,6-dichloro-4-fluorosulfonylphenyl)diazenyl]-N-ethylanilino]ethyl acetate.
| Compound Name | 2-[4-[(2-bromo-3,6-dichloro-4-fluorosulfonylphenyl)diazenyl]-N-ethylanilino]ethyl acetate |
|---|---|
| PubChem CID | 18793667 |
| Molecular Formula | C18H17BrCl2FN3O4S |
| Molecular Weight | 541.23 g/mol |
| Exact Mass | 538.95 |
| IUPAC Name | 2-[4-[(2-bromo-3,6-dichloro-4-fluorosulfonylphenyl)diazenyl]-N-ethylanilino]ethyl acetate |
| SMILES | CCN(CCOC(C)=O)c1ccc(/N=N/c2c(Cl)cc(S(=O)(=O)F)c(Cl)c2Br)cc1 |
| InChI | InChI=1S/C18H17BrCl2FN3O4S/c1-3-25(8-9-29-11(2)26)13-6-4-12(5-7-13)23-24-18-14(20)10-15(30(22,27)28)17(21)16(18)19/h4-7,10H,3,8-9H2,1-2H3/b24-23+ |
| InChIKey | DRSAARFBABAZEC-WCWDXBQESA-N |
| XLogP | 6.22 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.23 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|