C22H24Br2N4 — CID 92842583
N,N'-bis[(Z)-[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-N,N'-dimethylethane-1,2-diamine (PubChem CID 92842583) has the molecular formula C22H24Br2N4 and a molecular weight of 504.27 g/mol. Its IUPAC name is N,N'-bis[(Z)-[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis[(Z)-[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 92842583 |
| Molecular Formula | C22H24Br2N4 |
| Molecular Weight | 504.27 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | N,N'-bis[(Z)-[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCN(C)/N=C\C(Br)=C/c1ccccc1)/N=C\C(Br)=C/c1ccccc1 |
| InChI | InChI=1S/C22H24Br2N4/c1-27(25-17-21(23)15-19-9-5-3-6-10-19)13-14-28(2)26-18-22(24)16-20-11-7-4-8-12-20/h3-12,15-18H,13-14H2,1-2H3/b21-15+,22-16+,25-17-,26-18- |
| InChIKey | VMAPIJPUAVPTJE-GGQGVTHUSA-N |
| XLogP | 5.69 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.27 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|