C14H22N3O2+ — CID 9058516
(Z)-1-(3,5-dimethoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine (PubChem CID 9058516) has the molecular formula C14H22N3O2+ and a molecular weight of 264.35 g/mol. Its IUPAC name is (Z)-1-(3,5-dimethoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine.
| Compound Name | (Z)-1-(3,5-dimethoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine |
|---|---|
| PubChem CID | 9058516 |
| Molecular Formula | C14H22N3O2+ |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (Z)-1-(3,5-dimethoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine |
| SMILES | COc1cc(/C=N\N2CC[NH+](C)CC2)cc(OC)c1 |
| InChI | InChI=1S/C14H21N3O2/c1-16-4-6-17(7-5-16)15-11-12-8-13(18-2)10-14(9-12)19-3/h8-11H,4-7H2,1-3H3/p+1/b15-11- |
| InChIKey | ZUAQSKQGYBJILL-PTNGSMBKSA-O |
| XLogP | -0.13 |
| TPSA | 38.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|