C15H21ClN3O2+ — CID 9211174
(Z)-1-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine (PubChem CID 9211174) has the molecular formula C15H21ClN3O2+ and a molecular weight of 310.81 g/mol. Its IUPAC name is (Z)-1-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine.
| Compound Name | (Z)-1-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine |
|---|---|
| PubChem CID | 9211174 |
| Molecular Formula | C15H21ClN3O2+ |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (Z)-1-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine |
| SMILES | C[NH+]1CCN(/N=C\c2cc(Cl)c3c(c2)OCCCO3)CC1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-18-3-5-19(6-4-18)17-11-12-9-13(16)15-14(10-12)20-7-2-8-21-15/h9-11H,2-8H2,1H3/p+1/b17-11- |
| InChIKey | MQFOTXQDDIDIFU-BOPFTXTBSA-O |
| XLogP | 0.67 |
| TPSA | 38.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|