C18H15N3O5S2 — CID 6898426
3-[(E)-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6898426) has the molecular formula C18H15N3O5S2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-[(E)-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[(E)-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6898426 |
| Molecular Formula | C18H15N3O5S2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 3-[(E)-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=N/N2C(=O)CSC2=S)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15N3O5S2/c1-25-16-8-13(9-19-20-17(22)11-28-18(20)27)4-7-15(16)26-10-12-2-5-14(6-3-12)21(23)24/h2-9H,10-11H2,1H3/b19-9+ |
| InChIKey | KYRSNVDAHONCQR-DJKKODMXSA-N |
| XLogP | 3.38 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|