C13H12N2O4 — CID 78829908
2,3-dihydro-1,4-benzodioxin-6-yl 1-methylpyrazole-4-carboxylate (PubChem CID 78829908) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl 1-methylpyrazole-4-carboxylate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl 1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 78829908 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl 1-methylpyrazole-4-carboxylate |
| SMILES | Cn1cc(C(=O)Oc2ccc3c(c2)OCCO3)cn1 |
| InChI | InChI=1S/C13H12N2O4/c1-15-8-9(7-14-15)13(16)19-10-2-3-11-12(6-10)18-5-4-17-11/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | AYZXGEAKMOGMQN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|