C14H13N5O2 — CID 86819167
[3-(1-methyl-1,2,4-triazol-3-yl)phenyl] 1-methylpyrazole-4-carboxylate (PubChem CID 86819167) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is [3-(1-methyl-1,2,4-triazol-3-yl)phenyl] 1-methylpyrazole-4-carboxylate.
| Compound Name | [3-(1-methyl-1,2,4-triazol-3-yl)phenyl] 1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 86819167 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | [3-(1-methyl-1,2,4-triazol-3-yl)phenyl] 1-methylpyrazole-4-carboxylate |
| SMILES | Cn1cc(C(=O)Oc2cccc(-c3ncn(C)n3)c2)cn1 |
| InChI | InChI=1S/C14H13N5O2/c1-18-8-11(7-16-18)14(20)21-12-5-3-4-10(6-12)13-15-9-19(2)17-13/h3-9H,1-2H3 |
| InChIKey | JRHKAEGLUCPOKN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|