About (1-methylpyrazol-4-yl) 3-cyanobenzoate
(1-methylpyrazol-4-yl) 3-cyanobenzoate (PubChem CID 86814188) has the molecular formula C12H9N3O2
and a molecular weight of 227.22 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl) 3-cyanobenzoate.
Molecular Properties
| Compound Name | (1-methylpyrazol-4-yl) 3-cyanobenzoate |
| PubChem CID | 86814188 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (1-methylpyrazol-4-yl) 3-cyanobenzoate |
| SMILES | Cn1cc(OC(=O)c2cccc(C#N)c2)cn1 |
| InChI | InChI=1S/C12H9N3O2/c1-15-8-11(7-14-15)17-12(16)10-4-2-3-9(5-10)6-13/h2-5,7-8H,1H3 |
| InChIKey | TZTOYSYXVJJOPZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylpyrazol-4-yl) 3-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrazol-4-yl) 3-cyanobenzoate?
The IUPAC name of (1-methylpyrazol-4-yl) 3-cyanobenzoate (CID 86814188) is (1-methylpyrazol-4-yl) 3-cyanobenzoate.
What is the SMILES notation for (1-methylpyrazol-4-yl) 3-cyanobenzoate?
The canonical SMILES for (1-methylpyrazol-4-yl) 3-cyanobenzoate is Cn1cc(OC(=O)c2cccc(C#N)c2)cn1.
What is the InChIKey of (1-methylpyrazol-4-yl) 3-cyanobenzoate?
The InChIKey is TZTOYSYXVJJOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O2/c1-15-8-11(7-14-15)17-12(16)10-4-2-3-9(5-10)6-13/h2-5,7-8H,1H3.
What are the key properties of (1-methylpyrazol-4-yl) 3-cyanobenzoate?
(1-methylpyrazol-4-yl) 3-cyanobenzoate has a molecular weight of 227.22 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrazol-4-yl) 3-cyanobenzoate is sourced from PubChem (CID 86814188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).