About 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde
3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde (PubChem CID 163359544) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde.
Molecular Properties
| Compound Name | 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde |
| PubChem CID | 163359544 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde |
| SMILES | Cn1cnc(-c2cccc(C=O)c2)n1 |
| InChI | InChI=1S/C10H9N3O/c1-13-7-11-10(12-13)9-4-2-3-8(5-9)6-14/h2-7H,1H3 |
| InChIKey | DCZUMQHSVDMSEY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde?
The IUPAC name of 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde (CID 163359544) is 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde.
What is the SMILES notation for 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde?
The canonical SMILES for 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde is Cn1cnc(-c2cccc(C=O)c2)n1.
What is the InChIKey of 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde?
The InChIKey is DCZUMQHSVDMSEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c1-13-7-11-10(12-13)9-4-2-3-8(5-9)6-14/h2-7H,1H3.
What are the key properties of 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde?
3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde has a molecular weight of 187.20 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methyl-1,2,4-triazol-3-yl)benzaldehyde is sourced from PubChem (CID 163359544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).