C35H35FO8 — CID 139409043
[3-methyl-4-(3-prop-2-enoyloxypropoxy)phenyl] 7-[4-(2-fluoroprop-2-enoyloxy)butoxy]-9-methyl-9H-fluorene-2-carboxylate (PubChem CID 139409043) has the molecular formula C35H35FO8 and a molecular weight of 602.66 g/mol. Its IUPAC name is [3-methyl-4-(3-prop-2-enoyloxypropoxy)phenyl] 7-[4-(2-fluoroprop-2-enoyloxy)butoxy]-9-methyl-9H-fluorene-2-carboxylate.
| Compound Name | [3-methyl-4-(3-prop-2-enoyloxypropoxy)phenyl] 7-[4-(2-fluoroprop-2-enoyloxy)butoxy]-9-methyl-9H-fluorene-2-carboxylate |
|---|---|
| PubChem CID | 139409043 |
| Molecular Formula | C35H35FO8 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | [3-methyl-4-(3-prop-2-enoyloxypropoxy)phenyl] 7-[4-(2-fluoroprop-2-enoyloxy)butoxy]-9-methyl-9H-fluorene-2-carboxylate |
| SMILES | C=CC(=O)OCCCOc1ccc(OC(=O)c2ccc3c(c2)C(C)c2cc(OCCCCOC(=O)C(=C)F)ccc2-3)cc1C |
| InChI | InChI=1S/C35H35FO8/c1-5-33(37)42-18-8-17-41-32-14-11-27(19-22(32)2)44-35(39)25-9-12-28-29-13-10-26(21-31(29)23(3)30(28)20-25)40-15-6-7-16-43-34(38)24(4)36/h5,9-14,19-21,23H,1,4,6-8,15-18H2,2-3H3 |
| InChIKey | DDCLGVQDKAMWIJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|