C21H18O3 — CID 67472357
[9-methyl-7-(2-oxobut-3-enyl)-9H-fluoren-2-yl] prop-2-enoate (PubChem CID 67472357) has the molecular formula C21H18O3 and a molecular weight of 318.37 g/mol. Its IUPAC name is [9-methyl-7-(2-oxobut-3-enyl)-9H-fluoren-2-yl] prop-2-enoate.
| Compound Name | [9-methyl-7-(2-oxobut-3-enyl)-9H-fluoren-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 67472357 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [9-methyl-7-(2-oxobut-3-enyl)-9H-fluoren-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)Cc1ccc2c(c1)C(C)c1cc(OC(=O)C=C)ccc1-2 |
| InChI | InChI=1S/C21H18O3/c1-4-15(22)10-14-6-8-17-18-9-7-16(24-21(23)5-2)12-20(18)13(3)19(17)11-14/h4-9,11-13H,1-2,10H2,3H3 |
| InChIKey | RKZIQVBEKMYBEY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|